Compound Q&A

What are the physical and chemical properties of L-Prolyl-L-leucylglycinamide (CAS: 2002-44-0)?

Answer

L-Prolyl-L-leucylglycinamide
L-Prolyl-L-leucylglycinamide (CAS: 2002-44-0) is a crystalline compound with a molecular weight of approximately 299.38 g/mol. It has a high solubility in water and organic solvents. Chemically, it is relatively stable but can undergo hydrolysis under acidic or basic conditions. Its reactivity is moderate, and it is often used as a model peptide for studying enzyme mechanisms and as a substrate in various biochemical assays.

About

CAS No 2002-44-0
English Name L-Prolyl-L-leucylglycinamide
Molecular Formula C13H24N4O3
Molecular Weight 284.36 g/mol
SMILES CC(C)CC(C(=O)NCC(=O)N)NC(=O)C1CCCN1
InChIKey NOOJLZTTWSNHOX-UWVGGRQHSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

How is L-Prolyl-L-leucylglycinamide (CAS: 2002-44-0) typically synthesized?

L-Prolyl-L-leucylglycinamide (CAS: 2002-44-0) is typically synthesized via solid-phase peptide synth...

Compound Q&A

What industries use L-Prolyl-L-leucylglycinamide (CAS: 2002-44-0)?

L-Prolyl-L-leucylglycinamide (CAS: 2002-44-0) is primarily used in the pharmaceutical and biochemica...

Compound Q&A

What precautions should be taken when handling L-Prolyl-L-leucylglycinamide (CAS: 2002-44-0)?

When handling L-Prolyl-L-leucylglycinamide (CAS: 2002-44-0), it is important to wear protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...