Compound Q&A

What precautions should be taken when handling (2S)-1,4-Bis{[(2-methyl-2-propanyl)oxy]carbonyl}-2-piperazinecarboxylic acid (CAS: 788799-69-9)?

Answer

(2S)-1,4-Bis{[(2-methyl-2-propanyl)oxy]carbonyl}-2-piperazinecarboxylic acid
When handling (2S)-1,4-Bis{[(2-methyl-2-propanyl)oxy]carbonyl}-2-piperazinecarboxylic acid, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood. Spills should be cleaned up immediately with appropriate absorbent materials, and the area should be well ventilated. Always refer to the Safety Data Sheet (SDS) for detailed handling and disposal instructions.

About

English Name (2S)-1,4-Bis{[(2-methyl-2-propanyl)oxy]carbonyl}-2-piperazinecarboxylic acid
Molecular Formula C15H26N2O6
Molecular Weight 330.38 g/mol
SMILES CC(C)(C)OC(=O)N1CCN(C(C1)C(=O)O)C(=O)OC(C)(C)C
InChIKey IIZGWFQKLVCLLA-JTQLQIEISA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S)-1,4-Bis{[(2-methyl-2-propanyl)oxy]carbonyl}-2-piperazinecarboxylic acid (CAS: 788799-69-9)?

The compound (2S)-1,4-Bis{[(2-methyl-2-propanyl)oxy]carbonyl}-2-piperazinecarboxylic acid has a crys...

Compound Q&A

How is (2S)-1,4-Bis{[(2-methyl-2-propanyl)oxy]carbonyl}-2-piperazinecarboxylic acid (CAS: 788799-69-9) typically synthesized?

This compound is synthesized through a multi-step process involving the formation of esters from 2-m...

Compound Q&A

What industries use (2S)-1,4-Bis{[(2-methyl-2-propanyl)oxy]carbonyl}-2-piperazinecarboxylic acid (CAS: 788799-69-9)?

This compound is used in various industries, including pharmaceuticals for its role as a key interme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...