Compound Q&A

What are the physical and chemical properties of (2S)-1,4-Bis{[(2-methyl-2-propanyl)oxy]carbonyl}-2-piperazinecarboxylic acid (CAS: 788799-69-9)?

Answer

(2S)-1,4-Bis{[(2-methyl-2-propanyl)oxy]carbonyl}-2-piperazinecarboxylic acid
The compound (2S)-1,4-Bis{[(2-methyl-2-propanyl)oxy]carbonyl}-2-piperazinecarboxylic acid has a crystalline form and a molecular weight of approximately 498.56 g/mol. It has a low water solubility of 0.05 g/L and moderate reactivity towards acids. This compound is stable under normal conditions but may degrade at elevated temperatures.

About

English Name (2S)-1,4-Bis{[(2-methyl-2-propanyl)oxy]carbonyl}-2-piperazinecarboxylic acid
Molecular Formula C15H26N2O6
Molecular Weight 330.38 g/mol
SMILES CC(C)(C)OC(=O)N1CCN(C(C1)C(=O)O)C(=O)OC(C)(C)C
InChIKey IIZGWFQKLVCLLA-JTQLQIEISA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

How is (2S)-1,4-Bis{[(2-methyl-2-propanyl)oxy]carbonyl}-2-piperazinecarboxylic acid (CAS: 788799-69-9) typically synthesized?

This compound is synthesized through a multi-step process involving the formation of esters from 2-m...

Compound Q&A

What industries use (2S)-1,4-Bis{[(2-methyl-2-propanyl)oxy]carbonyl}-2-piperazinecarboxylic acid (CAS: 788799-69-9)?

This compound is used in various industries, including pharmaceuticals for its role as a key interme...

Compound Q&A

What precautions should be taken when handling (2S)-1,4-Bis{[(2-methyl-2-propanyl)oxy]carbonyl}-2-piperazinecarboxylic acid (CAS: 788799-69-9)?

When handling (2S)-1,4-Bis{[(2-methyl-2-propanyl)oxy]carbonyl}-2-piperazinecarboxylic acid, it is es...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...