Compound Q&A

How should Mitoquinone mesylate (CAS: 845959-50-4) be stored?

Answer

Mitoquinone mesylate
Mitoquinone mesylate (CAS: 845959-50-4) should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent moisture and light exposure. The temperature should be maintained below 30°C to ensure stability and safety.

About

English Name Mitoquinone mesylate
Molecular Formula C38H47O7PS
Molecular Weight 678.81 g/mol
SMILES CC1=C(C(=O)C(=C(C1=O)OC)OC)CCCCCCCCCC[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.CS(=O)(=O)[O-]
InChIKey GVZFUVXPTPGOQT-UHFFFAOYSA-M
Last Updated: 2025-11-12 20:35

Related Q&A

Compound Q&A

What is Mitoquinone mesylate (CAS: 845959-50-4)?

Mitoquinone mesylate (CAS: 845959-50-4) is a chemical compound that acts as a quinone derivative. It...

Compound Q&A

What are the main uses of Mitoquinone mesylate (CAS: 845959-50-4)?

Mitoquinone mesylate (CAS: 845959-50-4) is primarily used in scientific research for its antioxidant...

Compound Q&A

Is Mitoquinone mesylate (CAS: 845959-50-4) safe?

Mitoquinone mesylate (CAS: 845959-50-4) is generally considered safe when handled with appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...