Compound Q&A

What are the main uses of Mitoquinone mesylate (CAS: 845959-50-4)?

Answer

Mitoquinone mesylate
Mitoquinone mesylate (CAS: 845959-50-4) is primarily used in scientific research for its antioxidant and mitochondrial protective effects. It is also used in the development of potential therapeutic agents for various diseases, including neurodegenerative disorders and cardiovascular diseases.

About

English Name Mitoquinone mesylate
Molecular Formula C38H47O7PS
Molecular Weight 678.81 g/mol
SMILES CC1=C(C(=O)C(=C(C1=O)OC)OC)CCCCCCCCCC[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.CS(=O)(=O)[O-]
InChIKey GVZFUVXPTPGOQT-UHFFFAOYSA-M
Last Updated: 2025-11-12 20:35

Related Q&A

Compound Q&A

What is Mitoquinone mesylate (CAS: 845959-50-4)?

Mitoquinone mesylate (CAS: 845959-50-4) is a chemical compound that acts as a quinone derivative. It...

Compound Q&A

Is Mitoquinone mesylate (CAS: 845959-50-4) safe?

Mitoquinone mesylate (CAS: 845959-50-4) is generally considered safe when handled with appropriate p...

Compound Q&A

How should Mitoquinone mesylate (CAS: 845959-50-4) be stored?

Mitoquinone mesylate (CAS: 845959-50-4) should be stored in a cool, dry place away from direct sunli...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...