Compound Q&A

How should 4-(Methylcarbamoyl)benzene-1-sulfonyl chloride (CAS: 874622-79-4) be stored?

Answer

4-(Methylcarbamoyl)benzene-1-sulfonyl chloride
4-(Methylcarbamoyl)benzene-1-sulfonyl chloride (CAS: 874622-79-4) should be stored in a cool, dry, and well-ventilated area. It should be kept away from heat, open flames, and incompatible materials. The compound should be stored in airtight, food-grade containers made of materials that do not react with the compound to ensure stability and safety. Avoid exposure to direct sunlight or other sources of intense light.

About

English Name 4-(Methylcarbamoyl)benzene-1-sulfonyl chloride
Molecular Formula C8H8ClNO3S
Molecular Weight 233.68 g/mol
SMILES CNC(=O)C1=CC=C(C=C1)S(=O)(=O)Cl
InChIKey BNMWGTKOMIXMRX-UHFFFAOYSA-N
Last Updated: 2025-11-12 11:45

Related Q&A

Compound Q&A

What is 4-(Methylcarbamoyl)benzene-1-sulfonyl chloride (CAS: 874622-79-4)?

4-(Methylcarbamoyl)benzene-1-sulfonyl chloride (CAS: 874622-79-4) is an organic compound with a mole...

Compound Q&A

What are the main uses of 4-(Methylcarbamoyl)benzene-1-sulfonyl chloride (CAS: 874622-79-4)?

4-(Methylcarbamoyl)benzene-1-sulfonyl chloride is primarily used in the synthesis of pharmaceuticals...

Compound Q&A

Is 4-(Methylcarbamoyl)benzene-1-sulfonyl chloride (CAS: 874622-79-4) safe?

4-(Methylcarbamoyl)benzene-1-sulfonyl chloride (CAS: 874622-79-4) is generally safe when handled wit...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...