Compound Q&A

Is 4-(Methylcarbamoyl)benzene-1-sulfonyl chloride (CAS: 874622-79-4) safe?

Answer

4-(Methylcarbamoyl)benzene-1-sulfonyl chloride
4-(Methylcarbamoyl)benzene-1-sulfonyl chloride (CAS: 874622-79-4) is generally safe when handled with appropriate precautions. However, it is a skin and eye irritant and can cause respiratory irritation if inhaled. Proper protective measures, such as the use of gloves, goggles, and a respirator, are necessary during handling. It should be stored away from heat and open flames, and in a well-ventilated area.

About

English Name 4-(Methylcarbamoyl)benzene-1-sulfonyl chloride
Molecular Formula C8H8ClNO3S
Molecular Weight 233.68 g/mol
SMILES CNC(=O)C1=CC=C(C=C1)S(=O)(=O)Cl
InChIKey BNMWGTKOMIXMRX-UHFFFAOYSA-N
Last Updated: 2025-11-12 11:45

Related Q&A

Compound Q&A

What is 4-(Methylcarbamoyl)benzene-1-sulfonyl chloride (CAS: 874622-79-4)?

4-(Methylcarbamoyl)benzene-1-sulfonyl chloride (CAS: 874622-79-4) is an organic compound with a mole...

Compound Q&A

What are the main uses of 4-(Methylcarbamoyl)benzene-1-sulfonyl chloride (CAS: 874622-79-4)?

4-(Methylcarbamoyl)benzene-1-sulfonyl chloride is primarily used in the synthesis of pharmaceuticals...

Compound Q&A

How should 4-(Methylcarbamoyl)benzene-1-sulfonyl chloride (CAS: 874622-79-4) be stored?

4-(Methylcarbamoyl)benzene-1-sulfonyl chloride (CAS: 874622-79-4) should be stored in a cool, dry, a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...