Compound Q&A

What is Gastrin-Releasing Peptide (CAS: 93755-85-2)?

Answer

Gastrin-Releasing Peptide, human
Gastrin-Releasing Peptide (GRP) is a bioactive peptide with a molecular weight of approximately 7.2 kDa. It plays a crucial role in stimulating the release of gastrin from G cells in the antrum of the stomach. GRP is a 27-amino acid peptide with the sequence Ac-IGFSLGDFLRKLLPEDRQSLYKQKKK-NH2.

About

CAS No 93755-85-2
English Name Gastrin-Releasing Peptide, human
Molecular Formula C130H204N38O31S2
Molecular Weight 2859.38 g/mol
SMILES CC(C)CC(C(=O)NC(CCSC)C(=O)N)NC(=O)C(CC1=CNC=N1)NC(=O)CNC(=O)C(C(C)C)NC(=O)C(C)NC(=O)C(CC2=CNC3=CC=CC=C32)NC(=O)C(CC4=CNC=N4)NC(=O)C(CC(=O)N)NC(=O)CNC(=O)C(CCCNC(=N)N)NC(=O)C5CCCN5C(=O)C(CC6=CC=C(C=C6)O)NC(=O)C(CCSC)NC(=O)C(CCCCN)NC(=O)C(C(C)O)NC(=O)C(CC(C)C)NC(=O)C(C(C)C)NC(=O)C(C(C)O)NC(=O)CNC(=O)CNC(=O)CNC(=O)C(C)NC(=O)C7CCCN7C(=O)C(CC(C)C)NC(=O)C8CCCN8C(=O)C(C(C)C)N
InChIKey PUBCCFNQJQKCNC-XKNFJVFFSA-N
Last Updated: 2025-11-12 11:45

Related Q&A

Compound Q&A

What are the main uses of Gastrin-Releasing Peptide (CAS: 93755-85-2)?

Gastrin-Releasing Peptide (GRP) is primarily used in research, particularly in studies related to ga...

Compound Q&A

Is Gastrin-Releasing Peptide (CAS: 93755-85-2) safe?

Gastrin-Releasing Peptide (GRP) is generally considered safe under controlled laboratory conditions....

Compound Q&A

How should Gastrin-Releasing Peptide (CAS: 93755-85-2) be stored?

Gastrin-Releasing Peptide (GRP) should be stored at -20°C to -80°C in the freezer to maintain its st...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...