Compound Q&A

How should waste containing Demethoxydeacetoxypseudolaric acid B (CAS: 82508-36-9) be handled?

Answer

Demethoxydeacetoxypseudolaric acid B
Waste containing Demethoxydeacetoxypseudolaric acid B (CAS: 82508-36-9) should be handled according to local and regulatory guidelines. Typically, this involves collecting waste liquids in appropriate containers, ensuring proper labeling, and disposing of them through professional waste disposal services. Environmental protection precautions, such as preventing spillage and ensuring safe transportation, are crucial to avoid environmental contamination and ensure worker safety.

About

CAS No 82508-36-9
English Name Demethoxydeacetoxypseudolaric acid B
Molecular Formula C20H24O7
Molecular Weight 376.4004 g/mol
SMILES C/C(=C\C=C\[C@@]1(C)OC(=O)[C@]23[C@]([C@H]1CC2)(O)CCC(=CC3)C(=O)O)/C(=O)O
InChIKey QPFFEVMIQIJTGZ-XYWPTNBISA-N
Last Updated: 2025-11-11 20:48

Related Q&A

Compound Q&A

What regulatory guidelines apply to Demethoxydeacetoxypseudolaric acid B (CAS: 82508-36-9)?

Demethoxydeacetoxypseudolaric acid B (CAS: 82508-36-9) is subject to various regulatory guidelines s...

Compound Q&A

Are there alternatives to Demethoxydeacetoxypseudolaric acid B in synthesis (CAS: 82508-36-9)?

In the synthesis of Demethoxydeacetoxypseudolaric acid B (CAS: 82508-36-9), there are alternative re...

Compound Q&A

What is the market or research trend for Demethoxydeacetoxypseudolaric acid B (CAS: 82508-36-9)?

The market and research trends for Demethoxydeacetoxypseudolaric acid B (CAS: 82508-36-9) are center...

155412-88-71-(3-Aminophenyl)-3-...
Compound Q&A

How should waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 19132-12-8) be handled?

Waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 191...

19132-12-81-(D-Ribofuranosyl)-...
Compound Q&A

What regulatory guidelines apply to 2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 2007919-81-3)?

2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 20079...

2007919-81-32-Methyl-2-propanyl ...
Compound Q&A

What is N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0)?

N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0) is a chemical compound with...

245056-66-0N-(4-Chloro-2-pyridi...