Compound Q&A

Are there alternatives to Demethoxydeacetoxypseudolaric acid B in synthesis (CAS: 82508-36-9)?

Answer

Demethoxydeacetoxypseudolaric acid B
In the synthesis of Demethoxydeacetoxypseudolaric acid B (CAS: 82508-36-9), there are alternative reagents and processes that can be used. For instance, researchers might consider using isomers or analogs such as dehydrodemethoxydeacetoxypseudolaric acid or other related compounds. These alternatives can offer similar functionalities while potentially simplifying the synthesis process or improving yield.

About

CAS No 82508-36-9
English Name Demethoxydeacetoxypseudolaric acid B
Molecular Formula C20H24O7
Molecular Weight 376.4004 g/mol
SMILES C/C(=C\C=C\[C@@]1(C)OC(=O)[C@]23[C@]([C@H]1CC2)(O)CCC(=CC3)C(=O)O)/C(=O)O
InChIKey QPFFEVMIQIJTGZ-XYWPTNBISA-N
Last Updated: 2025-11-11 20:48

Related Q&A

Compound Q&A

What regulatory guidelines apply to Demethoxydeacetoxypseudolaric acid B (CAS: 82508-36-9)?

Demethoxydeacetoxypseudolaric acid B (CAS: 82508-36-9) is subject to various regulatory guidelines s...

Compound Q&A

What is the market or research trend for Demethoxydeacetoxypseudolaric acid B (CAS: 82508-36-9)?

The market and research trends for Demethoxydeacetoxypseudolaric acid B (CAS: 82508-36-9) are center...

Compound Q&A

How should waste containing Demethoxydeacetoxypseudolaric acid B (CAS: 82508-36-9) be handled?

Waste containing Demethoxydeacetoxypseudolaric acid B (CAS: 82508-36-9) should be handled according ...

155412-88-71-(3-Aminophenyl)-3-...
Compound Q&A

How should waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 19132-12-8) be handled?

Waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 191...

19132-12-81-(D-Ribofuranosyl)-...
Compound Q&A

What regulatory guidelines apply to 2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 2007919-81-3)?

2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 20079...

2007919-81-32-Methyl-2-propanyl ...
Compound Q&A

What is N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0)?

N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0) is a chemical compound with...

245056-66-0N-(4-Chloro-2-pyridi...