Compound Q&A

What regulatory guidelines apply to Demethoxydeacetoxypseudolaric acid B (CAS: 82508-36-9)?

Answer

Demethoxydeacetoxypseudolaric acid B
Demethoxydeacetoxypseudolaric acid B (CAS: 82508-36-9) is subject to various regulatory guidelines such as the Globally Harmonized System of Classification and Labeling of Chemicals (GHS), European Union REACH regulations, and FDA/EPA requirements for chemical substances. Manufacturers and importers must ensure compliance with these regulations, including proper labeling, safety data sheets, and environmental considerations.

About

CAS No 82508-36-9
English Name Demethoxydeacetoxypseudolaric acid B
Molecular Formula C20H24O7
Molecular Weight 376.4004 g/mol
SMILES C/C(=C\C=C\[C@@]1(C)OC(=O)[C@]23[C@]([C@H]1CC2)(O)CCC(=CC3)C(=O)O)/C(=O)O
InChIKey QPFFEVMIQIJTGZ-XYWPTNBISA-N
Last Updated: 2025-11-11 20:48

Related Q&A

Compound Q&A

Are there alternatives to Demethoxydeacetoxypseudolaric acid B in synthesis (CAS: 82508-36-9)?

In the synthesis of Demethoxydeacetoxypseudolaric acid B (CAS: 82508-36-9), there are alternative re...

Compound Q&A

What is the market or research trend for Demethoxydeacetoxypseudolaric acid B (CAS: 82508-36-9)?

The market and research trends for Demethoxydeacetoxypseudolaric acid B (CAS: 82508-36-9) are center...

Compound Q&A

How should waste containing Demethoxydeacetoxypseudolaric acid B (CAS: 82508-36-9) be handled?

Waste containing Demethoxydeacetoxypseudolaric acid B (CAS: 82508-36-9) should be handled according ...

155412-88-71-(3-Aminophenyl)-3-...
Compound Q&A

How should waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 19132-12-8) be handled?

Waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 191...

19132-12-81-(D-Ribofuranosyl)-...
Compound Q&A

What regulatory guidelines apply to 2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 2007919-81-3)?

2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 20079...

2007919-81-32-Methyl-2-propanyl ...
Compound Q&A

What is N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0)?

N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0) is a chemical compound with...

245056-66-0N-(4-Chloro-2-pyridi...