Compound Q&A

What is the market or research trend for (2R)-2-[3-({1,3-Benzoxazol-2-yl[3-(4-methoxyphenoxy)propyl]amino}methyl)phenoxy]butanoic acid (CAS: 848259-27-8)?

Answer

(2R)-2-[3-({1,3-Benzoxazol-2-yl[3-(4-methoxyphenoxy)propyl]amino}methyl)phenoxy]butanoic acid
The compound shows growing interest in pharmaceutical and chemical research due to its unique structure and potential applications. Market trends indicate increasing investment in research and development, with a focus on its use in drug discovery and synthesis of complex molecules.

About

English Name (2R)-2-[3-({1,3-Benzoxazol-2-yl[3-(4-methoxyphenoxy)propyl]amino}methyl)phenoxy]butanoic acid
Molecular Formula C28H30N2O6
Molecular Weight 490.56 g/mol
SMILES CC[C@H](C(=O)O)Oc1cccc(c1)CN(CCCOc2ccc(cc2)OC)c3nc4ccccc4o3
InChIKey ZHKNLJLMDFQVHJ-RUZDIDTESA-N
Last Updated: 2025-11-08 19:13

Related Q&A

Compound Q&A

What regulatory guidelines apply to (2R)-2-[3-({1,3-Benzoxazol-2-yl[3-(4-methoxyphenoxy)propyl]amino}methyl)phenoxy]butanoic acid (CAS: 848259-27-8)?

This compound falls under various regulatory guidelines including GHS classification for hazardous c...

Compound Q&A

Are there alternatives to (2R)-2-[3-({1,3-Benzoxazol-2-yl[3-(4-methoxyphenoxy)propyl]amino}methyl)phenoxy]butanoic acid (CAS: 848259-27-8) in synthesis?

Alternative reagents such as benzoxazoles with different substituents or other amino acid derivative...

Compound Q&A

How should waste containing (2R)-2-[3-({1,3-Benzoxazol-2-yl[3-(4-methoxyphenoxy)propyl]amino}methyl)phenoxy]butanoic acid (CAS: 848259-27-8) be handled?

Waste containing this compound should be collected and stored in appropriate containers. Incineratio...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...