Compound Q&A

Are there alternatives to (2R)-2-[3-({1,3-Benzoxazol-2-yl[3-(4-methoxyphenoxy)propyl]amino}methyl)phenoxy]butanoic acid (CAS: 848259-27-8) in synthesis?

Answer

(2R)-2-[3-({1,3-Benzoxazol-2-yl[3-(4-methoxyphenoxy)propyl]amino}methyl)phenoxy]butanoic acid
Alternative reagents such as benzoxazoles with different substituents or other amino acid derivatives can serve as potential alternatives. Isomers of the compound or analogs with similar functional groups might be considered depending on the specific requirements of the synthesis.

About

English Name (2R)-2-[3-({1,3-Benzoxazol-2-yl[3-(4-methoxyphenoxy)propyl]amino}methyl)phenoxy]butanoic acid
Molecular Formula C28H30N2O6
Molecular Weight 490.56 g/mol
SMILES CC[C@H](C(=O)O)Oc1cccc(c1)CN(CCCOc2ccc(cc2)OC)c3nc4ccccc4o3
InChIKey ZHKNLJLMDFQVHJ-RUZDIDTESA-N
Last Updated: 2025-11-08 19:13

Related Q&A

Compound Q&A

What regulatory guidelines apply to (2R)-2-[3-({1,3-Benzoxazol-2-yl[3-(4-methoxyphenoxy)propyl]amino}methyl)phenoxy]butanoic acid (CAS: 848259-27-8)?

This compound falls under various regulatory guidelines including GHS classification for hazardous c...

Compound Q&A

What is the market or research trend for (2R)-2-[3-({1,3-Benzoxazol-2-yl[3-(4-methoxyphenoxy)propyl]amino}methyl)phenoxy]butanoic acid (CAS: 848259-27-8)?

The compound shows growing interest in pharmaceutical and chemical research due to its unique struct...

Compound Q&A

How should waste containing (2R)-2-[3-({1,3-Benzoxazol-2-yl[3-(4-methoxyphenoxy)propyl]amino}methyl)phenoxy]butanoic acid (CAS: 848259-27-8) be handled?

Waste containing this compound should be collected and stored in appropriate containers. Incineratio...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...