Compound Q&A

What are the physical and chemical properties of 1-[3-(1-Methyl-1H-pyrazol-4-yl)-5-oxo-5H-benzo[4,5]cyclohepta[1,2-b]pyridin-7-yl]-N-(2-pyridinylmethyl)methanesulfonamide (CAS: 1001917-37-8)?

Answer

1-[3-(1-Methyl-1H-pyrazol-4-yl)-5-oxo-5H-benzo[4,5]cyclohepta[1,2-b]pyridin-7-yl]-N-(2-pyridinylmethyl)methanesulfonamide
This compound is typically crystalline with a molecular weight of approximately 512.71 g/mol. It has low solubility in water but good solubility in organic solvents like methanol and acetonitrile. It exhibits high reactivity towards nucleophiles and can undergo various transformations under specific conditions. The compound is stable under normal laboratory conditions but reacts with strong bases and acids.

About

English Name 1-[3-(1-Methyl-1H-pyrazol-4-yl)-5-oxo-5H-benzo[4,5]cyclohepta[1,2-b]pyridin-7-yl]-N-(2-pyridinylmethyl)methanesulfonamide
Molecular Formula C25H21N5O3S
Molecular Weight 471.54 g/mol
SMILES Cn1ncc(c1)c1cnc2c(c1)c(=O)c1cc(ccc1cc2)CS(=O)(=O)NCc1ccccn1
InChIKey VMJFTOSOFDEKTM-UHFFFAOYSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

How is 1-[3-(1-Methyl-1H-pyrazol-4-yl)-5-oxo-5H-benzo[4,5]cyclohepta[1,2-b]pyridin-7-yl]-N-(2-pyridinylmethyl)methanesulfonamide (CAS: 1001917-37-8) typically synthesized?

This compound is synthesized via a multi-step process involving the condensation of pyridinylmethyla...

Compound Q&A

What industries use 1-[3-(1-Methyl-1H-pyrazol-4-yl)-5-oxo-5H-benzo[4,5]cyclohepta[1,2-b]pyridin-7-yl]-N-(2-pyridinylmethyl)methanesulfonamide (CAS: 1001917-37-8)?

This compound is primarily used in the pharmaceutical industry for its potential as a medicinal chem...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...