Compound Q&A

What industries use Formvar (CAS: 63148-64-1)?

Answer

Formvar(R)
Formvar (CAS: 63148-64-1) is widely used in the electronics and semiconductor industries due to its excellent electrical properties. It is also utilized in the polymer and pharmaceutical industries for coating and film applications. Formvar is known for its durability and chemical inertness, making it suitable for various industrial coatings.

About

CAS No 63148-64-1
English Name Formvar(R)
Molecular Formula MR3*OFV
Molecular Weight 85.9393 g/mol
SMILES C1C(C=CC2=C1C=CC(=C2)CC=C3C4=CC=CC=C4C5=C3C(=CC=C5)N)N6C7=C(C=C(C=C7)C8=CC9=C(C=C8)N(C1=CC=CC=C19)C1=CC=CC(=C1)C1=CC=CC=C1)C1=CC=CC=C16
InChIKey HGJQHSCCODDZCZ-UHFFFAOYSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

What are the physical and chemical properties of Formvar (CAS: 63148-64-1)?

Formvar (CAS: 63148-64-1) is an alkyd resin characterized by a high molecular weight and a crystalli...

Compound Q&A

How is Formvar (CAS: 63148-64-1) typically synthesized?

Formvar (CAS: 63148-64-1) is synthesized by the condensation of a mixture of dicarboxylic acids, usu...

Compound Q&A

What precautions should be taken when handling Formvar (CAS: 63148-64-1)?

When handling Formvar (CAS: 63148-64-1), it is important to use appropriate personal protective equi...

Compound Q&A

How is Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) typically synthesized?

Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) can be synth...

59713-58-5Ethyl 4-chlorothieno...
Compound Q&A

What regulatory guidelines apply to 5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2)?

5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2) is subject to various regula...

52562-50-25-Methyl-1H-indole-3...
Compound Q&A

What are the physical and chemical properties of (1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid (CAS: 223418-73-3)?

(1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid is a white...

223418-73-3(1,3-Dimethyl-2,4-di...
Compound Q&A

How should waste containing Sulfocostunolide A (CAS: 1016983-51-9) be handled?

Waste containing Sulfocostunolide A (CAS: 1016983-51-9) should be handled with c...

1016983-51-9Sulfocostunolide A