Compound Q&A

How is Formvar (CAS: 63148-64-1) typically synthesized?

Answer

Formvar(R)
Formvar (CAS: 63148-64-1) is synthesized by the condensation of a mixture of dicarboxylic acids, usually adipic acid and phthalic acid, with glycols. The process involves the controlled condensation under acidic or basic catalysis to achieve high molecular weight polymers with a specific degree of polymerization.

About

CAS No 63148-64-1
English Name Formvar(R)
Molecular Formula MR3*OFV
Molecular Weight 85.94 g/mol
SMILES C1C(C=CC2=C1C=CC(=C2)CC=C3C4=CC=CC=C4C5=C3C(=CC=C5)N)N6C7=C(C=C(C=C7)C8=CC9=C(C=C8)N(C1=CC=CC=C19)C1=CC=CC(=C1)C1=CC=CC=C1)C1=CC=CC=C16
InChIKey HGJQHSCCODDZCZ-UHFFFAOYSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

What are the physical and chemical properties of Formvar (CAS: 63148-64-1)?

Formvar (CAS: 63148-64-1) is an alkyd resin characterized by a high molecular weight and a crystalli...

Compound Q&A

What industries use Formvar (CAS: 63148-64-1)?

Formvar (CAS: 63148-64-1) is widely used in the electronics and semiconductor industries due to its ...

Compound Q&A

What precautions should be taken when handling Formvar (CAS: 63148-64-1)?

When handling Formvar (CAS: 63148-64-1), it is important to use appropriate personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...