Compound Q&A

How is Formvar (CAS: 63148-64-1) typically synthesized?

Answer

Formvar(R)
Formvar (CAS: 63148-64-1) is synthesized by the condensation of a mixture of dicarboxylic acids, usually adipic acid and phthalic acid, with glycols. The process involves the controlled condensation under acidic or basic catalysis to achieve high molecular weight polymers with a specific degree of polymerization.

About

CAS No 63148-64-1
English Name Formvar(R)
Molecular Formula MR3*OFV
Molecular Weight 85.9393 g/mol
SMILES C1C(C=CC2=C1C=CC(=C2)CC=C3C4=CC=CC=C4C5=C3C(=CC=C5)N)N6C7=C(C=C(C=C7)C8=CC9=C(C=C8)N(C1=CC=CC=C19)C1=CC=CC(=C1)C1=CC=CC=C1)C1=CC=CC=C16
InChIKey HGJQHSCCODDZCZ-UHFFFAOYSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

What are the physical and chemical properties of Formvar (CAS: 63148-64-1)?

Formvar (CAS: 63148-64-1) is an alkyd resin characterized by a high molecular weight and a crystalli...

Compound Q&A

What industries use Formvar (CAS: 63148-64-1)?

Formvar (CAS: 63148-64-1) is widely used in the electronics and semiconductor industries due to its ...

Compound Q&A

What precautions should be taken when handling Formvar (CAS: 63148-64-1)?

When handling Formvar (CAS: 63148-64-1), it is important to use appropriate personal protective equi...

Compound Q&A

How is Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) typically synthesized?

Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) can be synth...

59713-58-5Ethyl 4-chlorothieno...
Compound Q&A

What regulatory guidelines apply to 5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2)?

5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2) is subject to various regula...

52562-50-25-Methyl-1H-indole-3...
Compound Q&A

What are the physical and chemical properties of (1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid (CAS: 223418-73-3)?

(1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid is a white...

223418-73-3(1,3-Dimethyl-2,4-di...
Compound Q&A

How should waste containing Sulfocostunolide A (CAS: 1016983-51-9) be handled?

Waste containing Sulfocostunolide A (CAS: 1016983-51-9) should be handled with c...

1016983-51-9Sulfocostunolide A