Compound Q&A

How is Methyl 2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS: 363185-87-9) typically synthesized?

Answer

Methyl 2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate
Methyl 2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate is typically synthesized via a multistep process involving the formation of an aryl boronic acid derivative followed by its coupling with a carboxylic acid. This reaction is catalyzed by palladium and often involves the use of a base like potassium carbonate. The overall yield is moderate to good, with high selectivity for the desired product.

About

English Name Methyl 2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate
Molecular Formula C14H20BNO4
Molecular Weight 277.129 g/mol
SMILES B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)N)C(=O)OC
InChIKey DQZPCTKBZUCRNT-UHFFFAOYSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS: 363185-87-9)?

Methyl 2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate is a white crystalline solid ...

Compound Q&A

What industries use Methyl 2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS: 363185-87-9)?

Methyl 2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate is primarily used in the phar...

Compound Q&A

What precautions should be taken when handling Methyl 2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS: 363185-87-9)?

When handling Methyl 2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, it is importan...

Compound Q&A

What are the physical and chemical properties of Ethyl 5-nitro-1-benzofuran-2-carboxylate (CAS: 69604-00-8)?

Ethyl 5-nitro-1-benzofuran-2-carboxylate (CAS: 69604-00-8) is a crystalline soli...

69604-00-8Ethyl 5-nitro-1-benz...
2296719-34-9N-{3-[({2-[(4-Hydrox...
Compound Q&A

How should waste containing Tetraamminepalladium(II) chloride hydrate (CAS: 13933-31-8) be handled?

Waste containing Tetraamminepalladium(II) chloride hydrate (CAS: 13933-31-8) sho...

13933-31-8Tetraamminepalladium...
Compound Q&A

What are the main uses of 2-[7-(tert-Butyl)pyren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 1270030-08-4)?

This compound is primarily used in organic synthesis, particularly for the prepa...

1270030-08-42-[7-(tert-Butyl)pyr...