Compound Q&A

How is 2,3,4,4',5,6-Hexachlorobiphenyl (CAS: 41411-63-6) typically synthesized?

Answer

2,3,4,4',5,6-Hexachlorobiphenyl
2,3,4,4',5,6-Hexachlorobiphenyl is typically synthesized through the chlorination of biphenyl using chlorine gas. The process involves multiple chlorination steps, and the reaction is often carried out in a solvent such as carbon tetrachloride. The yield and selectivity can be optimized using appropriate conditions and catalysts.

About

CAS No 41411-63-6
English Name 2,3,4,4',5,6-Hexachlorobiphenyl
Molecular Formula C12H4Cl6
Molecular Weight 360.88199999999995 g/mol
SMILES C1=CC(=CC=C1C2=C(C(=C(C(=C2Cl)Cl)Cl)Cl)Cl)Cl
InChIKey BTOCFTAWZMMTNB-UHFFFAOYSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,3,4,4',5,6-Hexachlorobiphenyl (CAS: 41411-63-6)?

2,3,4,4',5,6-Hexachlorobiphenyl (CAS: 41411-63-6) is a crystalline solid with a molecular weight of ...

Compound Q&A

What industries use 2,3,4,4',5,6-Hexachlorobiphenyl (CAS: 41411-63-6)?

2,3,4,4',5,6-Hexachlorobiphenyl was historically used in the production of flame retardants, plastic...

Compound Q&A

What precautions should be taken when handling 2,3,4,4',5,6-Hexachlorobiphenyl (CAS: 41411-63-6)?

When handling 2,3,4,4',5,6-Hexachlorobiphenyl, it is crucial to wear appropriate personal protective...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...