Compound Q&A

How is 2,3,4,4',5,6-Hexachlorobiphenyl (CAS: 41411-63-6) typically synthesized?

Answer

2,3,4,4',5,6-Hexachlorobiphenyl
2,3,4,4',5,6-Hexachlorobiphenyl is typically synthesized through the chlorination of biphenyl using chlorine gas. The process involves multiple chlorination steps, and the reaction is often carried out in a solvent such as carbon tetrachloride. The yield and selectivity can be optimized using appropriate conditions and catalysts.

About

CAS No 41411-63-6
English Name 2,3,4,4',5,6-Hexachlorobiphenyl
Molecular Formula C12H4Cl6
Molecular Weight 360.88 g/mol
SMILES C1=CC(=CC=C1C2=C(C(=C(C(=C2Cl)Cl)Cl)Cl)Cl)Cl
InChIKey BTOCFTAWZMMTNB-UHFFFAOYSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,3,4,4',5,6-Hexachlorobiphenyl (CAS: 41411-63-6)?

2,3,4,4',5,6-Hexachlorobiphenyl (CAS: 41411-63-6) is a crystalline solid with a molecular weight of ...

Compound Q&A

What industries use 2,3,4,4',5,6-Hexachlorobiphenyl (CAS: 41411-63-6)?

2,3,4,4',5,6-Hexachlorobiphenyl was historically used in the production of flame retardants, plastic...

Compound Q&A

What precautions should be taken when handling 2,3,4,4',5,6-Hexachlorobiphenyl (CAS: 41411-63-6)?

When handling 2,3,4,4',5,6-Hexachlorobiphenyl, it is crucial to wear appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...