Compound Q&A

What are the physical and chemical properties of 2,3,4,4',5,6-Hexachlorobiphenyl (CAS: 41411-63-6)?

Answer

2,3,4,4',5,6-Hexachlorobiphenyl
2,3,4,4',5,6-Hexachlorobiphenyl (CAS: 41411-63-6) is a crystalline solid with a molecular weight of approximately 364.84 g/mol. It has a low solubility in water but is highly soluble in organic solvents. This compound is not reactive under normal conditions but can undergo photodegradation. It is known for its persistence in the environment and bioaccumulation potential.

About

CAS No 41411-63-6
English Name 2,3,4,4',5,6-Hexachlorobiphenyl
Molecular Formula C12H4Cl6
Molecular Weight 360.88199999999995 g/mol
SMILES C1=CC(=CC=C1C2=C(C(=C(C(=C2Cl)Cl)Cl)Cl)Cl)Cl
InChIKey BTOCFTAWZMMTNB-UHFFFAOYSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

How is 2,3,4,4',5,6-Hexachlorobiphenyl (CAS: 41411-63-6) typically synthesized?

2,3,4,4',5,6-Hexachlorobiphenyl is typically synthesized through the chlorination of biphenyl using ...

Compound Q&A

What industries use 2,3,4,4',5,6-Hexachlorobiphenyl (CAS: 41411-63-6)?

2,3,4,4',5,6-Hexachlorobiphenyl was historically used in the production of flame retardants, plastic...

Compound Q&A

What precautions should be taken when handling 2,3,4,4',5,6-Hexachlorobiphenyl (CAS: 41411-63-6)?

When handling 2,3,4,4',5,6-Hexachlorobiphenyl, it is crucial to wear appropriate personal protective...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...