Compound Q&A

What are the physical and chemical properties of 4-Amino-3-(4-fluorophenyl)butanoic acid (CAS: 52237-19-1)?

Answer

4-Amino-3-(4-fluorophenyl)butanoic acid
4-Amino-3-(4-fluorophenyl)butanoic acid (CAS: 52237-19-1) is a white crystalline solid with a molecular weight of approximately 231.18 g/mol. It has a solubility of about 12 mg/mL in water and exhibits good solubility in organic solvents such as methanol and ethanol. The compound is moderately reactive, showing basic properties due to the amino group, and can form salts with acids. It is also susceptible to hydrolysis under acidic conditions.

About

CAS No 52237-19-1
English Name 4-Amino-3-(4-fluorophenyl)butanoic acid
Molecular Formula C10H12FNO2
Molecular Weight 197.20899999999997 g/mol
SMILES C1=CC(=CC=C1C(CC(=O)O)CN)F
InChIKey QWHXHLDNSXLAPX-UHFFFAOYSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

How is 4-Amino-3-(4-fluorophenyl)butanoic acid (CAS: 52237-19-1) typically synthesized?

4-Amino-3-(4-fluorophenyl)butanoic acid is typically synthesized via a multistep process involving t...

Compound Q&A

What industries use 4-Amino-3-(4-fluorophenyl)butanoic acid (CAS: 52237-19-1)?

4-Amino-3-(4-fluorophenyl)butanoic acid (CAS: 52237-19-1) is primarily used in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling 4-Amino-3-(4-fluorophenyl)butanoic acid (CAS: 52237-19-1)?

When handling 4-Amino-3-(4-fluorophenyl)butanoic acid (CAS: 52237-19-1), it is crucial to wear appro...

Compound Q&A

What are the physical and chemical properties of 4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0)?

4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0) is a crys...

2040295-11-04,4',4'',4'''-(1,1,2...
Compound Q&A

Are there alternatives to (3beta)-Abieta-8,11,13-triene-3,12-diol (CAS: 564-73-8) in synthesis?

There are several alternatives to (3beta)-Abieta-8,11,13-triene-3,12-diol in syn...

564-73-8(3beta)-Abieta-8,11,...
Compound Q&A

What are the main uses of sec-Butylhydrazine dihydrochloride (CAS: 1177361-36-2)?

Sec-Butylhydrazine dihydrochloride is mainly used as a precursor in the synthesi...

1177361-36-2sec-Butylhydrazine d...
Compound Q&A

How is BIBP3226 TFA (CAS: 1068148-47-9) typically synthesized?

BIBP3226 TFA is synthesized via a multi-step process involving amino acid deriva...

1068148-47-9BIBP3226 TFA