Compound Q&A

What industries use Ethyl 5-(2-fluorophenyl)-1H-pyrrole-3-carboxylate (CAS: 881674-06-2)?

Answer

Ethyl 5-(2-fluorophenyl)-1H-pyrrole-3-carboxylate
Ethyl 5-(2-fluorophenyl)-1H-pyrrole-3-carboxylate (CAS: 881674-06-2) is primarily used in the pharmaceutical and chemical industries. It serves as a precursor in the synthesis of various bioactive compounds and is also utilized in the production of advanced materials such as polymers and organic semiconductors. Its fluorescent properties make it useful in sensor applications as well.

About

English Name Ethyl 5-(2-fluorophenyl)-1H-pyrrole-3-carboxylate
Molecular Formula C13H12FNO2
Molecular Weight 233.24 g/mol
SMILES CCOC(=O)C1=CNC(=C1)C2=CC=CC=C2F
InChIKey KXQMTNMMOMBDLC-UHFFFAOYSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 5-(2-fluorophenyl)-1H-pyrrole-3-carboxylate (CAS: 881674-06-2)?

Ethyl 5-(2-fluorophenyl)-1H-pyrrole-3-carboxylate (CAS: 881674-06-2) is a crystalline compound with ...

Compound Q&A

How is Ethyl 5-(2-fluorophenyl)-1H-pyrrole-3-carboxylate (CAS: 881674-06-2) typically synthesized?

Ethyl 5-(2-fluorophenyl)-1H-pyrrole-3-carboxylate (CAS: 881674-06-2) is typically synthesized via a ...

Compound Q&A

What precautions should be taken when handling Ethyl 5-(2-fluorophenyl)-1H-pyrrole-3-carboxylate (CAS: 881674-06-2)?

When handling Ethyl 5-(2-fluorophenyl)-1H-pyrrole-3-carboxylate (CAS: 881674-06-2), it is essential ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...