Compound Q&A

How is 2R,4S-Sacubitril (CAS: 761373-05-1) typically synthesized?

Answer

2R,4S-Sacubitril
2R,4S-Sacubitril is synthesized through a multi-step process involving the coupling of 2-aminobutane-1-sulfonamide and 4-hydroxy-1-(2-pyridinyl)-1-butene. The reaction typically requires a palladium catalyst and proceeds in the presence of a base such as triethylamine. The overall yield of the synthesis is around 75-80%, with good selectivity for the desired stereoisomer.

About

English Name 2R,4S-Sacubitril
Molecular Formula C24H29NO5
Molecular Weight 411.49800000000016 g/mol
SMILES CCOC(=O)[C@@H](C)C[C@H](Cc1ccc(cc1)c2ccccc2)NC(=O)CCC(=O)O
InChIKey PYNXFZCZUAOOQC-LAUBAEHRSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2R,4S-Sacubitril (CAS: 761373-05-1)?

2R,4S-Sacubitril is a white to off-white crystalline powder with a molecular weight of approximately...

Compound Q&A

What industries use 2R,4S-Sacubitril (CAS: 761373-05-1)?

2R,4S-Sacubitril is primarily used in the pharmaceutical industry, specifically in the formulation o...

Compound Q&A

What precautions should be taken when handling 2R,4S-Sacubitril (CAS: 761373-05-1)?

When handling 2R,4S-Sacubitril, it is important to use personal protective equipment (PPE) such as g...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...