Compound Q&A

What are the physical and chemical properties of (1S,2S)-1,2-Diphenyl-1,2-ethanediol (CAS: 655-48-1)?

Answer

(1S,2S)-1,2-Diphenyl-1,2-ethanediol
(1S,2S)-1,2-Diphenyl-1,2-ethanediol is a colorless crystalline solid with a molecular weight of approximately 254.31 g/mol. It is slightly soluble in water and readily soluble in common organic solvents. Chemically, it is relatively stable but can react with strong acids or bases. Its physical properties include a melting point of 60-62°C and a density around 1.13 g/cm³.

About

CAS No 655-48-1
English Name (1S,2S)-1,2-Diphenyl-1,2-ethanediol
Molecular Formula C14H14O2
Molecular Weight 214.26 g/mol
SMILES C1=CC=C(C=C1)C(C(C2=CC=CC=C2)O)O
InChIKey IHPDTPWNFBQHEB-KBPBESRZSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

How is (1S,2S)-1,2-Diphenyl-1,2-ethanediol (CAS: 655-48-1) typically synthesized?

(1S,2S)-1,2-Diphenyl-1,2-ethanediol can be synthesized through a Wittig reaction or a Grignard react...

Compound Q&A

What industries use (1S,2S)-1,2-Diphenyl-1,2-ethanediol (CAS: 655-48-1)?

(1S,2S)-1,2-Diphenyl-1,2-ethanediol is primarily used in the pharmaceutical industry as a precursor ...

Compound Q&A

What precautions should be taken when handling (1S,2S)-1,2-Diphenyl-1,2-ethanediol (CAS: 655-48-1)?

When handling (1S,2S)-1,2-Diphenyl-1,2-ethanediol, it is essential to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...