Compound Q&A

What industries use 3,5-Bis(benzyloxy)benzyl Bromide (CAS: 24131-32-6)?

Answer

3,5-Bis(benzyloxy)benzyl Bromide
3,5-Bis(benzyloxy)benzyl Bromide (CAS: 24131-32-6) is used in the pharmaceutical industry for the synthesis of various drugs, particularly those requiring protection of phenolic groups. It is also utilized in the polymer industry as a monomer for the production of special polymers. Additionally, it finds applications in the sensor and semiconductor industries due to its reactivity and stability.

About

CAS No 24131-32-6
English Name 3,5-Bis(benzyloxy)benzyl Bromide
Molecular Formula C21H19BrO2
Molecular Weight 383.29 g/mol
SMILES C1=CC=C(C=C1)COC2=CC(=CC(=C2)CBr)OCC3=CC=CC=C3
InChIKey WGMYJGAUAQXYFQ-UHFFFAOYSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,5-Bis(benzyloxy)benzyl Bromide (CAS: 24131-32-6)?

3,5-Bis(benzyloxy)benzyl Bromide (CAS: 24131-32-6) has a crystalline form with a molecular weight of...

Compound Q&A

How is 3,5-Bis(benzyloxy)benzyl Bromide (CAS: 24131-32-6) typically synthesized?

3,5-Bis(benzyloxy)benzyl Bromide (CAS: 24131-32-6) is typically synthesized via a multistep reaction...

Compound Q&A

What precautions should be taken when handling 3,5-Bis(benzyloxy)benzyl Bromide (CAS: 24131-32-6)?

When handling 3,5-Bis(benzyloxy)benzyl Bromide (CAS: 24131-32-6), it is essential to use appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...