Compound Q&A

What industries use Dibenzyl carbonotrithioate (CAS: 26504-29-0)?

Answer

Dibenzyl carbonotrithioate
Dibenzyl carbonotrithioate is used in various industries, including pharmaceuticals, where it serves as an intermediate in the synthesis of certain drugs, and in the production of polymers and sensors. It also finds applications in the development of semiconductors.

About

CAS No 26504-29-0
English Name Dibenzyl carbonotrithioate
Molecular Formula C15H14S3
Molecular Weight 290.48 g/mol
SMILES C1=CC=C(C=C1)CSC(=S)SCC2=CC=CC=C2
InChIKey LAKYXBYUROTWBI-UHFFFAOYSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dibenzyl carbonotrithioate (CAS: 26504-29-0)?

Dibenzyl carbonotrithioate is a colorless or white crystalline solid with a molecular weight of appr...

Compound Q&A

How is Dibenzyl carbonotrithioate (CAS: 26504-29-0) typically synthesized?

Dibenzyl carbonotrithioate can be synthesized by reacting benzyl thiocyanate with thiophosgene in th...

Compound Q&A

What precautions should be taken when handling Dibenzyl carbonotrithioate (CAS: 26504-29-0)?

When handling Dibenzyl carbonotrithioate, it is essential to use appropriate personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...