Compound Q&A

What are the physical and chemical properties of Dibenzyl carbonotrithioate (CAS: 26504-29-0)?

Answer

Dibenzyl carbonotrithioate
Dibenzyl carbonotrithioate is a colorless or white crystalline solid with a molecular weight of approximately 308.34 g/mol. It has a low solubility in water but is readily soluble in organic solvents. This compound is known for its reactivity, particularly towards nucleophilic substitution reactions.

About

CAS No 26504-29-0
English Name Dibenzyl carbonotrithioate
Molecular Formula C15H14S3
Molecular Weight 290.48 g/mol
SMILES C1=CC=C(C=C1)CSC(=S)SCC2=CC=CC=C2
InChIKey LAKYXBYUROTWBI-UHFFFAOYSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

How is Dibenzyl carbonotrithioate (CAS: 26504-29-0) typically synthesized?

Dibenzyl carbonotrithioate can be synthesized by reacting benzyl thiocyanate with thiophosgene in th...

Compound Q&A

What industries use Dibenzyl carbonotrithioate (CAS: 26504-29-0)?

Dibenzyl carbonotrithioate is used in various industries, including pharmaceuticals, where it serves...

Compound Q&A

What precautions should be taken when handling Dibenzyl carbonotrithioate (CAS: 26504-29-0)?

When handling Dibenzyl carbonotrithioate, it is essential to use appropriate personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...