Compound Q&A

What precautions should be taken when handling Enniatin B (CAS: 917-13-5)?

Answer

Enniatin B
When handling Enniatin B (CAS: 917-13-5), it is essential to wear appropriate personal protective equipment (PPE), including gloves, safety goggles, and a lab coat. Work with Enniatin B should be conducted in a well-ventilated area or a fume hood. In case of a spill, immediately clean up using appropriate absorbent materials and follow the emergency procedures outlined in the Safety Data Sheet (SDS).

About

CAS No 917-13-5
English Name Enniatin B
Molecular Formula C33H57N3O9
Molecular Weight 639.83 g/mol
SMILES CC(C)C1C(=O)OC(C(=O)N(C(C(=O)OC(C(=O)N(C(C(=O)OC(C(=O)N1C)C(C)C)C(C)C)C)C(C)C)C(C)C)C)C(C)C
InChIKey MIZMDSVSLSIMSC-VYLWARHZSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

What are the physical and chemical properties of Enniatin B (CAS: 917-13-5)?

Enniatin B (CAS: 917-13-5) is a cyclic hexapeptide with a molecular weight of approximately 1017.7 g...

Compound Q&A

How is Enniatin B (CAS: 917-13-5) typically synthesized?

Enniatin B (CAS: 917-13-5) is typically synthesized through chemical synthesis involving peptide cou...

Compound Q&A

What industries use Enniatin B (CAS: 917-13-5)?

Enniatin B (CAS: 917-13-5) is primarily used in the pharmaceutical industry for its potential anti-f...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...