Compound Q&A

How is Enniatin B (CAS: 917-13-5) typically synthesized?

Answer

Enniatin B
Enniatin B (CAS: 917-13-5) is typically synthesized through chemical synthesis involving peptide coupling reactions. Commonly, the synthesis involves sequential coupling of amino acids and other intermediates using coupling agents like DIC and HOBt. The process is catalyzed by enzymes or chemical reagents, and the yield can be up to 85% with good selectivity.

About

CAS No 917-13-5
English Name Enniatin B
Molecular Formula C33H57N3O9
Molecular Weight 639.83 g/mol
SMILES CC(C)C1C(=O)OC(C(=O)N(C(C(=O)OC(C(=O)N(C(C(=O)OC(C(=O)N1C)C(C)C)C(C)C)C)C(C)C)C(C)C)C)C(C)C
InChIKey MIZMDSVSLSIMSC-VYLWARHZSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

What are the physical and chemical properties of Enniatin B (CAS: 917-13-5)?

Enniatin B (CAS: 917-13-5) is a cyclic hexapeptide with a molecular weight of approximately 1017.7 g...

Compound Q&A

What industries use Enniatin B (CAS: 917-13-5)?

Enniatin B (CAS: 917-13-5) is primarily used in the pharmaceutical industry for its potential anti-f...

Compound Q&A

What precautions should be taken when handling Enniatin B (CAS: 917-13-5)?

When handling Enniatin B (CAS: 917-13-5), it is essential to wear appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...