Compound Q&A

How is 1,4-Cyclohexanediylbis(methylene) dibenzoate (CAS: 35541-81-2) typically synthesized?

Answer

1,4-Cyclohexanediylbis(methylene) dibenzoate
1,4-Cyclohexanediylbis(methylene) dibenzoate is typically synthesized via the condensation reaction of 4-hydroxybenzoic acid and 1,4-cyclohexanedione using a catalyst such as p-toluenesulfonic acid. The process yields the desired dibenzoate compound with high selectivity and good yield under mild conditions.

About

CAS No 35541-81-2
English Name 1,4-Cyclohexanediylbis(methylene) dibenzoate
Molecular Formula C22H24O4
Molecular Weight 352.43 g/mol
SMILES O=C(OCC1CCC(COC(C2=CC=CC=C2)=O)CC1)C3=CC=CC=C3
InChIKey CVPZXHCZKMFVOZ-UHFFFAOYSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,4-Cyclohexanediylbis(methylene) dibenzoate (CAS: 35541-81-2)?

1,4-Cyclohexanediylbis(methylene) dibenzoate (CAS: 35541-81-2) is a crystalline compound with a mole...

Compound Q&A

What industries use 1,4-Cyclohexanediylbis(methylene) dibenzoate (CAS: 35541-81-2)?

1,4-Cyclohexanediylbis(methylene) dibenzoate (CAS: 35541-81-2) is primarily used in the pharmaceutic...

Compound Q&A

What precautions should be taken when handling 1,4-Cyclohexanediylbis(methylene) dibenzoate (CAS: 35541-81-2)?

When handling 1,4-Cyclohexanediylbis(methylene) dibenzoate (CAS: 35541-81-2), it is important to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...