Compound Q&A

What are the physical and chemical properties of 1,4-Cyclohexanediylbis(methylene) dibenzoate (CAS: 35541-81-2)?

Answer

1,4-Cyclohexanediylbis(methylene) dibenzoate
1,4-Cyclohexanediylbis(methylene) dibenzoate (CAS: 35541-81-2) is a crystalline compound with a molecular weight of approximately 316.26 g/mol. It is poorly soluble in water but soluble in organic solvents such as ethanol and acetone. Chemically, it is stable under normal conditions but may react with strong bases. Its reactivity is moderate, and it does not generally require special handling or storage conditions.

About

CAS No 35541-81-2
English Name 1,4-Cyclohexanediylbis(methylene) dibenzoate
Molecular Formula C22H24O4
Molecular Weight 352.43 g/mol
SMILES O=C(OCC1CCC(COC(C2=CC=CC=C2)=O)CC1)C3=CC=CC=C3
InChIKey CVPZXHCZKMFVOZ-UHFFFAOYSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

How is 1,4-Cyclohexanediylbis(methylene) dibenzoate (CAS: 35541-81-2) typically synthesized?

1,4-Cyclohexanediylbis(methylene) dibenzoate is typically synthesized via the condensation reaction ...

Compound Q&A

What industries use 1,4-Cyclohexanediylbis(methylene) dibenzoate (CAS: 35541-81-2)?

1,4-Cyclohexanediylbis(methylene) dibenzoate (CAS: 35541-81-2) is primarily used in the pharmaceutic...

Compound Q&A

What precautions should be taken when handling 1,4-Cyclohexanediylbis(methylene) dibenzoate (CAS: 35541-81-2)?

When handling 1,4-Cyclohexanediylbis(methylene) dibenzoate (CAS: 35541-81-2), it is important to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...