Compound Q&A

What industries use Andrographidine C (CAS: 113963-39-6)?

Answer

Andrographidine C
Andrographidine C finds applications in the pharmaceutical industry, particularly in the development of anti-inflammatory and antiviral drugs. It is also used in the production of natural health products and dietary supplements. Additionally, it has potential uses in the cosmetic industry and as a flavor enhancer in food products.

About

English Name Andrographidine C
Molecular Formula C23H24O10
Molecular Weight 460.4 g/mol
SMILES COC1=C(C2=C(C(=C1)OC3C(C(C(C(O3)CO)O)O)O)C(=O)C=C(O2)C4=CC=CC=C4)OC
InChIKey WGCQDTNINMCFAY-PUIBNRJISA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

What are the physical and chemical properties of Andrographidine C (CAS: 113963-39-6)?

Andrographidine C is a white crystalline powder with a molecular weight of approximately 346.34 g/mo...

Compound Q&A

How is Andrographidine C (CAS: 113963-39-6) typically synthesized?

Andrographidine C can be synthesized through a multistep process involving the condensation of andro...

Compound Q&A

What precautions should be taken when handling Andrographidine C (CAS: 113963-39-6)?

Handling Andrographidine C requires the use of personal protective equipment (PPE) such as gloves, s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...