Compound Q&A

How is Andrographidine C (CAS: 113963-39-6) typically synthesized?

Answer

Andrographidine C
Andrographidine C can be synthesized through a multistep process involving the condensation of andrographolide with an appropriate nucleophile. Common methods include the use of thymol as a starting material, followed by Wittig reactions and subsequent hydrogenation. The overall yield is moderate, and the process requires careful control of temperature and pH to achieve high selectivity.

About

English Name Andrographidine C
Molecular Formula C23H24O10
Molecular Weight 460.4 g/mol
SMILES COC1=C(C2=C(C(=C1)OC3C(C(C(C(O3)CO)O)O)O)C(=O)C=C(O2)C4=CC=CC=C4)OC
InChIKey WGCQDTNINMCFAY-PUIBNRJISA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

What are the physical and chemical properties of Andrographidine C (CAS: 113963-39-6)?

Andrographidine C is a white crystalline powder with a molecular weight of approximately 346.34 g/mo...

Compound Q&A

What industries use Andrographidine C (CAS: 113963-39-6)?

Andrographidine C finds applications in the pharmaceutical industry, particularly in the development...

Compound Q&A

What precautions should be taken when handling Andrographidine C (CAS: 113963-39-6)?

Handling Andrographidine C requires the use of personal protective equipment (PPE) such as gloves, s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...