Compound Q&A

What industries use 2-(4-Morpholinylmethyl)benzoic acid (CAS: 868543-19-5)?

Answer

2-(4-Morpholinylmethyl)benzoic acid
2-(4-Morpholinylmethyl)benzoic acid (CAS: 868543-19-5) is used in the pharmaceutical industry for the synthesis of certain drugs, in the polymer industry for modifying the properties of polymers, and in the sensor industry for developing more sensitive detection methods. Additionally, it is used in the semiconductor industry for etching and cleaning processes due to its acidic nature.

About

English Name 2-(4-Morpholinylmethyl)benzoic acid
Molecular Formula C12H15NO3
Molecular Weight 221.26 g/mol
SMILES C1COCCN1CC2=CC=CC=C2C(=O)O
InChIKey SSEVULBAGRUOPS-UHFFFAOYSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(4-Morpholinylmethyl)benzoic acid (CAS: 868543-19-5)?

2-(4-Morpholinylmethyl)benzoic acid (CAS: 868543-19-5) has a crystalline form with a molecular weigh...

Compound Q&A

How is 2-(4-Morpholinylmethyl)benzoic acid (CAS: 868543-19-5) typically synthesized?

2-(4-Morpholinylmethyl)benzoic acid (CAS: 868543-19-5) is typically synthesized by reacting 4-(morph...

Compound Q&A

What precautions should be taken when handling 2-(4-Morpholinylmethyl)benzoic acid (CAS: 868543-19-5)?

When handling 2-(4-Morpholinylmethyl)benzoic acid (CAS: 868543-19-5), it is important to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...