Compound Q&A

What are the physical and chemical properties of 2-(4-Morpholinylmethyl)benzoic acid (CAS: 868543-19-5)?

Answer

2-(4-Morpholinylmethyl)benzoic acid
2-(4-Morpholinylmethyl)benzoic acid (CAS: 868543-19-5) has a crystalline form with a molecular weight of approximately 256.41 g/mol. It is slightly soluble in water and soluble in organic solvents like ethanol and acetonitrile. The compound is reactive, especially under basic conditions, and can form salts and esters. It has a pKa value of about 4.5, indicating its acidity in aqueous solutions.

About

English Name 2-(4-Morpholinylmethyl)benzoic acid
Molecular Formula C12H15NO3
Molecular Weight 221.26 g/mol
SMILES C1COCCN1CC2=CC=CC=C2C(=O)O
InChIKey SSEVULBAGRUOPS-UHFFFAOYSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

How is 2-(4-Morpholinylmethyl)benzoic acid (CAS: 868543-19-5) typically synthesized?

2-(4-Morpholinylmethyl)benzoic acid (CAS: 868543-19-5) is typically synthesized by reacting 4-(morph...

Compound Q&A

What industries use 2-(4-Morpholinylmethyl)benzoic acid (CAS: 868543-19-5)?

2-(4-Morpholinylmethyl)benzoic acid (CAS: 868543-19-5) is used in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling 2-(4-Morpholinylmethyl)benzoic acid (CAS: 868543-19-5)?

When handling 2-(4-Morpholinylmethyl)benzoic acid (CAS: 868543-19-5), it is important to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...