Compound Q&A

What are the physical and chemical properties of (3S)-N,N-Dimethyl-3-(1-naphthyloxy)-3-(2-thienyl)-1-propanamine (CAS: 132335-46-7)?

Answer

(3S)-N,N-Dimethyl-3-(1-naphthyloxy)-3-(2-thienyl)-1-propanamine
(3S)-N,N-Dimethyl-3-(1-naphthyloxy)-3-(2-thienyl)-1-propanamine is a solid with a crystalline form. Its molecular weight is approximately 322.32 g/mol. It has limited solubility in water but is more soluble in organic solvents like methanol and ethanol. This compound is known for its stability in air and does not react readily with common reagents. It is not flammable and has a low vapor pressure, making it safe for handling under normal laboratory conditions.

About

English Name (3S)-N,N-Dimethyl-3-(1-naphthyloxy)-3-(2-thienyl)-1-propanamine
Molecular Formula C19H21NOS
Molecular Weight 311.45 g/mol
SMILES CN(C)CCC(C1=CC=CS1)OC2=CC=CC3=CC=CC=C32
InChIKey JFTURWWGPMTABQ-SFHVURJKSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

How is (3S)-N,N-Dimethyl-3-(1-naphthyloxy)-3-(2-thienyl)-1-propanamine (CAS: 132335-46-7) typically synthesized?

(3S)-N,N-Dimethyl-3-(1-naphthyloxy)-3-(2-thienyl)-1-propanamine can be synthesized through a multi-s...

Compound Q&A

What industries use (3S)-N,N-Dimethyl-3-(1-naphthyloxy)-3-(2-thienyl)-1-propanamine (CAS: 132335-46-7)?

(3S)-N,N-Dimethyl-3-(1-naphthyloxy)-3-(2-thienyl)-1-propanamine finds applications in the pharmaceut...

Compound Q&A

What precautions should be taken when handling (3S)-N,N-Dimethyl-3-(1-naphthyloxy)-3-(2-thienyl)-1-propanamine (CAS: 132335-46-7)?

When handling (3S)-N,N-Dimethyl-3-(1-naphthyloxy)-3-(2-thienyl)-1-propanamine, it is crucial to use ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...