Compound Q&A

What precautions should be taken when handling Proanthocyanidin A4 (CAS: 111466-29-6)?

Answer

Proanthocyanidin A4
Proanthocyanidin A4 (CAS: 111466-29-6) should be handled in a fume hood to minimize exposure to air. Wear appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. Store in a cool, dry place away from heat sources and direct sunlight. In case of spill, immediately clean up using appropriate absorbent materials and refer to the Safety Data Sheet (SDS) for further instructions.

About

English Name Proanthocyanidin A4
Molecular Formula C30H24O12
Molecular Weight 576.51 g/mol
SMILES OC1Cc2c(O)cc3OC4(Oc5cc(O)cc(O)c5C(C4O)c3c2OC1c1ccc(O)c(O)c1)c1ccc(O)c(O)c1
InChIKey NSEWTSAADLNHNH-UHFFFAOYSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

What are the physical and chemical properties of Proanthocyanidin A4 (CAS: 111466-29-6)?

Proanthocyanidin A4 (CAS: 111466-29-6) is a polyphenol with a molecular weight of approximately 1,32...

Compound Q&A

How is Proanthocyanidin A4 (CAS: 111466-29-6) typically synthesized?

Proanthocyanidin A4 (CAS: 111466-29-6) is synthesized through the condensation of flavan-3-ol monome...

Compound Q&A

What industries use Proanthocyanidin A4 (CAS: 111466-29-6)?

Proanthocyanidin A4 (CAS: 111466-29-6) finds applications in the pharmaceutical industry for its ant...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...