Compound Q&A

How is Proanthocyanidin A4 (CAS: 111466-29-6) typically synthesized?

Answer

Proanthocyanidin A4
Proanthocyanidin A4 (CAS: 111466-29-6) is synthesized through the condensation of flavan-3-ol monomers. Common synthetic methods include the use of Lewis acids or organometallic catalysts, which lead to high yields and good selectivity. The synthesis typically involves multi-step reactions, ensuring high purity and molecular integrity.

About

English Name Proanthocyanidin A4
Molecular Formula C30H24O12
Molecular Weight 576.51 g/mol
SMILES OC1Cc2c(O)cc3OC4(Oc5cc(O)cc(O)c5C(C4O)c3c2OC1c1ccc(O)c(O)c1)c1ccc(O)c(O)c1
InChIKey NSEWTSAADLNHNH-UHFFFAOYSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

What are the physical and chemical properties of Proanthocyanidin A4 (CAS: 111466-29-6)?

Proanthocyanidin A4 (CAS: 111466-29-6) is a polyphenol with a molecular weight of approximately 1,32...

Compound Q&A

What industries use Proanthocyanidin A4 (CAS: 111466-29-6)?

Proanthocyanidin A4 (CAS: 111466-29-6) finds applications in the pharmaceutical industry for its ant...

Compound Q&A

What precautions should be taken when handling Proanthocyanidin A4 (CAS: 111466-29-6)?

Proanthocyanidin A4 (CAS: 111466-29-6) should be handled in a fume hood to minimize exposure to air....

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...