Compound Q&A

How is Methyl (3R)-3-{[dimethyl(2-methyl-2-propanyl)silyl]oxy}-5-[(ethoxycarbonyl)oxy]-5-oxopentanoate (CAS: 158279-75-7) typically synthesized?

Answer

Methyl (3R)-3-{[dimethyl(2-methyl-2-propanyl)silyl]oxy}-5-[(ethoxycarbonyl)oxy]-5-oxopentanoate
The compound is synthesized via a multi-step process involving silylation and esterification. Commonly, dimethyl(2-methyl-2-propanyl)silane and ethyl chloroacetate are used, catalyzed by a suitable base. The reaction yields are moderate to good, and the product is isolated by recrystallization.

About

English Name Methyl (3R)-3-{[dimethyl(2-methyl-2-propanyl)silyl]oxy}-5-[(ethoxycarbonyl)oxy]-5-oxopentanoate
Molecular Formula C15H28O7Si
Molecular Weight 348.47 g/mol
SMILES CCOC(=O)OC(=O)CC(CC(=O)OC)O[Si](C)(C)C(C)(C)C
InChIKey BEVABXNTHJECLR-LLVKDONJSA-N
Last Updated: 2025-11-07 15:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl (3R)-3-{[dimethyl(2-methyl-2-propanyl)silyl]oxy}-5-[(ethoxycarbonyl)oxy]-5-oxopentanoate (CAS: 158275-79-7)?

The compound has a crystalline form with a molecular weight of approximately 352.43 g/mol. It is poo...

Compound Q&A

What industries use Methyl (3R)-3-{[dimethyl(2-methyl-2-propanyl)silyl]oxy}-5-[(ethoxycarbonyl)oxy]-5-oxopentanoate (CAS: 158275-79-7)?

This compound is primarily used in the pharmaceutical industry for intermediate steps in drug synthe...

Compound Q&A

What precautions should be taken when handling Methyl (3R)-3-{[dimethyl(2-methyl-2-propanyl)silyl]oxy}-5-[(ethoxycarbonyl)oxy]-5-oxopentanoate (CAS: 158275-79-7)?

Handling this compound requires careful attention to safety. Gloves, goggles, and a fume hood should...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...