Compound Q&A

How is tert-butyl N-(6-methoxy-2-pyridyl)carbamate (CAS: 855784-40-6) typically synthesized?

Answer

tert-butyl N-(6-methoxy-2-pyridyl)carbamate
Tert-butyl N-(6-methoxy-2-pyridyl)carbamate (CAS: 855784-40-6) is synthesized via a multi-step process involving the reaction of 6-methoxy-2-pyridinecarboxylic acid with tert-butyl isocyanate. Commonly, the synthesis involves the use of anhydrous conditions and a catalytic amount of a base such as triethylamine. The reaction yields a high purity product with good selectivity, typically around 90% yield.

About

English Name tert-butyl N-(6-methoxy-2-pyridyl)carbamate
Molecular Formula C11H16N2O3
Molecular Weight 224.25999999999996 g/mol
SMILES COc1cccc(NC(=O)OC(C)(C)C)n1
InChIKey BDYLIANVYQWWNB-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of tert-butyl N-(6-methoxy-2-pyridyl)carbamate (CAS: 855784-40-6)?

Tert-butyl N-(6-methoxy-2-pyridyl)carbamate (CAS: 855784-40-6) is a white to off-white crystalline s...

Compound Q&A

What industries use tert-butyl N-(6-methoxy-2-pyridyl)carbamate (CAS: 855784-40-6)?

Tert-butyl N-(6-methoxy-2-pyridyl)carbamate (CAS: 855784-40-6) is primarily used in the pharmaceutic...

Compound Q&A

What precautions should be taken when handling tert-butyl N-(6-methoxy-2-pyridyl)carbamate (CAS: 855784-40-6)?

When handling tert-butyl N-(6-methoxy-2-pyridyl)carbamate (CAS: 855784-40-6), it is important to use...

Compound Q&A

Is 2-(2-chloroacetamido)-3-phenylpropanoic acid (CAS: 7765-11-9) safe?

2-(2-Chloroacetamido)-3-phenylpropanoic acid (CAS: 7765-11-9) is generally consi...

7765-11-92-(2-chloroacetamido...
Compound Q&A

Is 2-(Benzyloxy)-5-bromobenzoic acid (CAS: 62176-31-2) safe?

2-(Benzyloxy)-5-bromobenzoic acid can be handled safely if appropriate precautio...

62176-31-22-(Benzyloxy)-5-brom...
Compound Q&A

What is (4-Methyl-1,2,5-oxadiazol-3-yl)methanamine hydrochloride (CAS: 1159825-48-5)?

(4-Methyl-1,2,5-oxadiazol-3-yl)methanamine hydrochloride is a chemical compound ...

1159825-48-5(4-Methyl-1,2,5-oxad...
Compound Q&A

What is 2-(5-Hexylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 917985-54-7)?

2-(5-Hexylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 917985-54...

917985-54-72-(5-Hexylthiophen-2...