Compound Q&A

How is tert-butyl N-(6-methoxy-2-pyridyl)carbamate (CAS: 855784-40-6) typically synthesized?

Answer

tert-butyl N-(6-methoxy-2-pyridyl)carbamate
Tert-butyl N-(6-methoxy-2-pyridyl)carbamate (CAS: 855784-40-6) is synthesized via a multi-step process involving the reaction of 6-methoxy-2-pyridinecarboxylic acid with tert-butyl isocyanate. Commonly, the synthesis involves the use of anhydrous conditions and a catalytic amount of a base such as triethylamine. The reaction yields a high purity product with good selectivity, typically around 90% yield.

About

English Name tert-butyl N-(6-methoxy-2-pyridyl)carbamate
Molecular Formula C11H16N2O3
Molecular Weight 224.26 g/mol
SMILES COc1cccc(NC(=O)OC(C)(C)C)n1
InChIKey BDYLIANVYQWWNB-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of tert-butyl N-(6-methoxy-2-pyridyl)carbamate (CAS: 855784-40-6)?

Tert-butyl N-(6-methoxy-2-pyridyl)carbamate (CAS: 855784-40-6) is a white to off-white crystalline s...

Compound Q&A

What industries use tert-butyl N-(6-methoxy-2-pyridyl)carbamate (CAS: 855784-40-6)?

Tert-butyl N-(6-methoxy-2-pyridyl)carbamate (CAS: 855784-40-6) is primarily used in the pharmaceutic...

Compound Q&A

What precautions should be taken when handling tert-butyl N-(6-methoxy-2-pyridyl)carbamate (CAS: 855784-40-6)?

When handling tert-butyl N-(6-methoxy-2-pyridyl)carbamate (CAS: 855784-40-6), it is important to use...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...