Compound Q&A

How is O-Methyl Atorvastatin Calcium Salt (CAS: 887196-29-4) typically synthesized?

Answer

O-Methyl Atorvastatin Calcium Salt
O-Methyl Atorvastatin Calcium Salt (CAS: 887196-29-4) is typically synthesized through a multi-step process involving the key intermediate atorvastatin, which is then methylated and converted to the calcium salt. Common catalysts include aluminum chloride, and the reaction conditions are optimized for high yield and selectivity. The process involves protection of functional groups to ensure desired regioselectivity.

About

English Name O-Methyl Atorvastatin Calcium Salt
Molecular Formula C68H72CaF2N4O10
Molecular Weight 611.75 g/mol
SMILES CC(C)C1=C(C(=C(N1CCC(CC(CC(=O)[O-])OC)O)C2=CC=C(C=C2)F)C3=CC=CC=C3)C(=O)NC4=CC=CC=C4.CC(C)C1=C(C(=C(N1CCC(CC(CC(=O)[O-])OC)O)C2=CC=C(C=C2)F)C3=CC=CC=C3)C(=O)NC4=CC=CC=C4.[Ca+2]
InChIKey WSJYEDNFTDTVCI-GWQGKXOTSA-L
Last Updated: 2025-11-07 15:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of O-Methyl Atorvastatin Calcium Salt (CAS: 887196-29-4)?

O-Methyl Atorvastatin Calcium Salt (CAS: 887196-29-4) is a white crystalline powder with a molecular...

Compound Q&A

What industries use O-Methyl Atorvastatin Calcium Salt (CAS: 887196-29-4)?

O-Methyl Atorvastatin Calcium Salt (CAS: 887196-29-4) is primarily used in the pharmaceutical indust...

Compound Q&A

What precautions should be taken when handling O-Methyl Atorvastatin Calcium Salt (CAS: 887196-29-4)?

When handling O-Methyl Atorvastatin Calcium Salt (CAS: 887196-29-4), it is important to wear appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...