Compound Q&A

What industries use 3-[(1R)-1-Aminoethyl]benzonitrile hydrochloride (CAS: 1286693-23-9)?

Answer

3-[(1R)-1-Aminoethyl]benzonitrile hydrochloride (1:1)
This compound is primarily used in the pharmaceutical industry for its amine functional group, which can be useful in drug synthesis. It also finds applications in polymer chemistry as a monomer and in sensor technology due to its reactivity and solubility properties.

About

English Name 3-[(1R)-1-Aminoethyl]benzonitrile hydrochloride (1:1)
Molecular Formula C9H11ClN2
Molecular Weight 182.65 g/mol
SMILES Cl.C[C@@H](N)c1cccc(C#N)c1
InChIKey UMKDPZGKJZQZAY-OGFXRTJISA-N
Last Updated: 2025-11-07 15:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-[(1R)-1-Aminoethyl]benzonitrile hydrochloride (CAS: 1286693-23-9)?

3-[(1R)-1-Aminoethyl]benzonitrile hydrochloride is a white crystalline solid with a molecular weight...

Compound Q&A

How is 3-[(1R)-1-Aminoethyl]benzonitrile hydrochloride (CAS: 1286693-23-9) typically synthesized?

3-[(1R)-1-Aminoethyl]benzonitrile hydrochloride is typically synthesized via a multistep process sta...

Compound Q&A

What precautions should be taken when handling 3-[(1R)-1-Aminoethyl]benzonitrile hydrochloride (CAS: 1286693-23-9)?

Proper personal protective equipment (PPE) should be worn when handling this compound, including glo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...