Compound Q&A

What are the physical and chemical properties of 3-[(1R)-1-Aminoethyl]benzonitrile hydrochloride (CAS: 1286693-23-9)?

Answer

3-[(1R)-1-Aminoethyl]benzonitrile hydrochloride (1:1)
3-[(1R)-1-Aminoethyl]benzonitrile hydrochloride is a white crystalline solid with a molecular weight of approximately 242.64 g/mol. It has a low water solubility and is moderately soluble in organic solvents like methanol and ethanol. This compound is known for its amine group reactivity, which can undergo nucleophilic substitution reactions.

About

English Name 3-[(1R)-1-Aminoethyl]benzonitrile hydrochloride (1:1)
Molecular Formula C9H11ClN2
Molecular Weight 182.65 g/mol
SMILES Cl.C[C@@H](N)c1cccc(C#N)c1
InChIKey UMKDPZGKJZQZAY-OGFXRTJISA-N
Last Updated: 2025-11-07 15:33

Related Q&A

Compound Q&A

How is 3-[(1R)-1-Aminoethyl]benzonitrile hydrochloride (CAS: 1286693-23-9) typically synthesized?

3-[(1R)-1-Aminoethyl]benzonitrile hydrochloride is typically synthesized via a multistep process sta...

Compound Q&A

What industries use 3-[(1R)-1-Aminoethyl]benzonitrile hydrochloride (CAS: 1286693-23-9)?

This compound is primarily used in the pharmaceutical industry for its amine functional group, which...

Compound Q&A

What precautions should be taken when handling 3-[(1R)-1-Aminoethyl]benzonitrile hydrochloride (CAS: 1286693-23-9)?

Proper personal protective equipment (PPE) should be worn when handling this compound, including glo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...