Compound Q&A

How is 4-Acetyl-2-fluorobenzonitrile (CAS: 214760-18-6) typically synthesized?

Answer

4-Acetyl-2-fluorobenzonitrile
4-Acetyl-2-fluorobenzonitrile is typically synthesized via the reaction of 2-fluorobenzonitrile with acetyl chloride in the presence of a base like sodium hydride. The reaction is selective and yields a high percentage of the desired product with good purity.

About

English Name 4-Acetyl-2-fluorobenzonitrile
Molecular Formula C9H6FNO
Molecular Weight 163.15 g/mol
SMILES CC(=O)C1=CC(=C(C=C1)C#N)F
InChIKey JWNHQAOIXWUFMG-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Acetyl-2-fluorobenzonitrile (CAS: 214760-18-6)?

4-Acetyl-2-fluorobenzonitrile (CAS: 214760-18-6) is a white solid with a molecular weight of 198.07 ...

Compound Q&A

What industries use 4-Acetyl-2-fluorobenzonitrile (CAS: 214760-18-6)?

4-Acetyl-2-fluorobenzonitrile (CAS: 214760-18-6) is primarily used in the pharmaceutical and chemica...

Compound Q&A

What precautions should be taken when handling 4-Acetyl-2-fluorobenzonitrile (CAS: 214760-18-6)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What is 3-Fluoro-2-methylbenzylamine (CAS: 771573-36-5)?

3-Fluoro-2-methylbenzylamine is an organic compound with the CAS number 771573-3...

771573-36-53-Fluoro-2-methylben...
Compound Q&A

Is Tert-butyl 2-(oxetan-3-ylidene)acetate (CAS: 1207175-03-8) safe?

Tert-butyl 2-(oxetan-3-ylidene)acetate is considered safe for its intended uses ...

1207175-03-8Tert-butyl 2-(oxetan...
Compound Q&A

What precautions should be taken when handling 4-Acetyl-2-fluorobenzonitrile (CAS: 214760-18-6)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab co...

214760-18-64-Acetyl-2-fluoroben...
Compound Q&A

How is 2-Ethyl-4-methyl-1,3-thiazole (CAS: 15679-12-6) typically synthesized?

2-Ethyl-4-methyl-1,3-thiazole is commonly synthesized via the reaction of thiour...

15679-12-62-Ethyl-4-methyl-1,3...