Compound Q&A

What are the physical and chemical properties of 4-Acetyl-2-fluorobenzonitrile (CAS: 214760-18-6)?

Answer

4-Acetyl-2-fluorobenzonitrile
4-Acetyl-2-fluorobenzonitrile (CAS: 214760-18-6) is a white solid with a molecular weight of 198.07 g/mol. It has a melting point of 59-61°C and is poorly soluble in water but soluble in organic solvents like ethanol and acetone. Chemically, it is relatively stable but can react with bases and certain nucleophiles.

About

English Name 4-Acetyl-2-fluorobenzonitrile
Molecular Formula C9H6FNO
Molecular Weight 163.15 g/mol
SMILES CC(=O)C1=CC(=C(C=C1)C#N)F
InChIKey JWNHQAOIXWUFMG-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:33

Related Q&A

Compound Q&A

How is 4-Acetyl-2-fluorobenzonitrile (CAS: 214760-18-6) typically synthesized?

4-Acetyl-2-fluorobenzonitrile is typically synthesized via the reaction of 2-fluorobenzonitrile with...

Compound Q&A

What industries use 4-Acetyl-2-fluorobenzonitrile (CAS: 214760-18-6)?

4-Acetyl-2-fluorobenzonitrile (CAS: 214760-18-6) is primarily used in the pharmaceutical and chemica...

Compound Q&A

What precautions should be taken when handling 4-Acetyl-2-fluorobenzonitrile (CAS: 214760-18-6)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What is 3-Fluoro-2-methylbenzylamine (CAS: 771573-36-5)?

3-Fluoro-2-methylbenzylamine is an organic compound with the CAS number 771573-3...

771573-36-53-Fluoro-2-methylben...
Compound Q&A

Is Tert-butyl 2-(oxetan-3-ylidene)acetate (CAS: 1207175-03-8) safe?

Tert-butyl 2-(oxetan-3-ylidene)acetate is considered safe for its intended uses ...

1207175-03-8Tert-butyl 2-(oxetan...
Compound Q&A

What precautions should be taken when handling 4-Acetyl-2-fluorobenzonitrile (CAS: 214760-18-6)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab co...

214760-18-64-Acetyl-2-fluoroben...
Compound Q&A

How is 2-Ethyl-4-methyl-1,3-thiazole (CAS: 15679-12-6) typically synthesized?

2-Ethyl-4-methyl-1,3-thiazole is commonly synthesized via the reaction of thiour...

15679-12-62-Ethyl-4-methyl-1,3...