Compound Q&A

What industries use 4-Amino-2-(ethylthio)pyrimidine-5-carboxylic acid (CAS: 89853-87-2)?

Answer

4-Amino-2-(ethylthio)pyrimidine-5-carboxylic acid
4-Amino-2-(ethylthio)pyrimidine-5-carboxylic acid is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various bioactive compounds. It also finds applications in the production of certain polymers and sensors due to its chemical reactivity and functional groups.

About

CAS No 89853-87-2
English Name 4-Amino-2-(ethylthio)pyrimidine-5-carboxylic acid
Molecular Formula C7H9N3O2S
Molecular Weight 199.235 g/mol
SMILES CCSC1=NC=C(C(=N1)N)C(=O)O
InChIKey TYAKXNHFMATCHA-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Amino-2-(ethylthio)pyrimidine-5-carboxylic acid (CAS: 89853-87-2)?

4-Amino-2-(ethylthio)pyrimidine-5-carboxylic acid is a crystalline solid with a molecular weight of ...

Compound Q&A

How is 4-Amino-2-(ethylthio)pyrimidine-5-carboxylic acid (CAS: 89853-87-2) typically synthesized?

4-Amino-2-(ethylthio)pyrimidine-5-carboxylic acid can be synthesized through a multi-step process in...

Compound Q&A

What precautions should be taken when handling 4-Amino-2-(ethylthio)pyrimidine-5-carboxylic acid (CAS: 89853-87-2)?

When handling 4-Amino-2-(ethylthio)pyrimidine-5-carboxylic acid, appropriate personal protective equ...

155412-88-71-(3-Aminophenyl)-3-...
Compound Q&A

How should waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 19132-12-8) be handled?

Waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 191...

19132-12-81-(D-Ribofuranosyl)-...
Compound Q&A

What regulatory guidelines apply to 2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 2007919-81-3)?

2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 20079...

2007919-81-32-Methyl-2-propanyl ...
Compound Q&A

What is N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0)?

N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0) is a chemical compound with...

245056-66-0N-(4-Chloro-2-pyridi...