Compound Q&A

How is 4-Amino-2-(ethylthio)pyrimidine-5-carboxylic acid (CAS: 89853-87-2) typically synthesized?

Answer

4-Amino-2-(ethylthio)pyrimidine-5-carboxylic acid
4-Amino-2-(ethylthio)pyrimidine-5-carboxylic acid can be synthesized through a multi-step process involving the condensation of ethyl ethylthioacetate with 2-amino-4-chloropyrimidine, followed by reduction of the chloride group. The synthesis typically uses sodium borohydride as a reducing agent, yielding a product with a purify yield of about 75-80%. The reaction conditions should be optimized for maximum selectivity and yield.

About

CAS No 89853-87-2
English Name 4-Amino-2-(ethylthio)pyrimidine-5-carboxylic acid
Molecular Formula C7H9N3O2S
Molecular Weight 199.24 g/mol
SMILES CCSC1=NC=C(C(=N1)N)C(=O)O
InChIKey TYAKXNHFMATCHA-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Amino-2-(ethylthio)pyrimidine-5-carboxylic acid (CAS: 89853-87-2)?

4-Amino-2-(ethylthio)pyrimidine-5-carboxylic acid is a crystalline solid with a molecular weight of ...

Compound Q&A

What industries use 4-Amino-2-(ethylthio)pyrimidine-5-carboxylic acid (CAS: 89853-87-2)?

4-Amino-2-(ethylthio)pyrimidine-5-carboxylic acid is primarily used in the pharmaceutical industry a...

Compound Q&A

What precautions should be taken when handling 4-Amino-2-(ethylthio)pyrimidine-5-carboxylic acid (CAS: 89853-87-2)?

When handling 4-Amino-2-(ethylthio)pyrimidine-5-carboxylic acid, appropriate personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...