Compound Q&A

What industries use 2-Amino-6-hydroxy-5-nitro-4(1H)-pyrimidinone (CAS: 80466-56-4)?

Answer

2-Amino-6-hydroxy-5-nitro-4(1H)-pyrimidinone
2-Amino-6-hydroxy-5-nitro-4(1H)-pyrimidinone finds applications in the pharmaceutical industry as a precursor for the synthesis of various medicinal compounds. It also has potential uses in the polymer industry for the development of functional polymers and in the sensor and semiconductor industries for material characterization and device fabrication.

About

CAS No 80466-56-4
English Name 2-Amino-6-hydroxy-5-nitro-4(1H)-pyrimidinone
Molecular Formula C4H4N4O4
Molecular Weight 172.1 g/mol
SMILES C1(=C(N=C(NC1=O)N)O)[N+](=O)[O-]
InChIKey ZEBYRLPUWQNZNY-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Amino-6-hydroxy-5-nitro-4(1H)-pyrimidinone (CAS: 80466-56-4)?

2-Amino-6-hydroxy-5-nitro-4(1H)-pyrimidinone is a crystalline solid with a molecular weight of appro...

Compound Q&A

How is 2-Amino-6-hydroxy-5-nitro-4(1H)-pyrimidinone (CAS: 80466-56-4) typically synthesized?

2-Amino-6-hydroxy-5-nitro-4(1H)-pyrimidinone can be synthesized through the nitration of 2-hydroxy-5...

Compound Q&A

What precautions should be taken when handling 2-Amino-6-hydroxy-5-nitro-4(1H)-pyrimidinone (CAS: 80466-56-4)?

When handling 2-Amino-6-hydroxy-5-nitro-4(1H)-pyrimidinone, it is essential to wear protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...