Compound Q&A

What are the physical and chemical properties of 2-Methoxy-5-(2-methyl-2-propanyl)aniline (CAS: 3535-88-4)?

Answer

2-Methoxy-5-(2-methyl-2-propanyl)aniline
2-Methoxy-5-(2-methyl-2-propanyl)aniline is a white crystalline solid with a molecular weight of approximately 228.34 g/mol. It is slightly soluble in water but soluble in organic solvents like ethanol and acetone. Chemically, it is moderately reactive, particularly in its substitution reactions. It has a melting point of 52-54°C and a boiling point of 250-252°C. It is slightly basic and can undergo typical aromatic reactions such as electrophilic substitution and nucleophilic aromatic substitution.

About

CAS No 3535-88-4
English Name 2-Methoxy-5-(2-methyl-2-propanyl)aniline
Molecular Formula C11H17NO
Molecular Weight 179.26 g/mol
SMILES CC(C)(C)C1=CC(=C(C=C1)OC)N
InChIKey DLTLFDQLMFMTRQ-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:33

Related Q&A

Compound Q&A

How is 2-Methoxy-5-(2-methyl-2-propanyl)aniline (CAS: 3535-88-4) typically synthesized?

2-Methoxy-5-(2-methyl-2-propanyl)aniline is typically synthesized via a Friedel-Crafts alkylation of...

Compound Q&A

What industries use 2-Methoxy-5-(2-methyl-2-propanyl)aniline (CAS: 3535-88-4)?

2-Methoxy-5-(2-methyl-2-propanyl)aniline finds application in various industries. It is used in the ...

Compound Q&A

What precautions should be taken when handling 2-Methoxy-5-(2-methyl-2-propanyl)aniline (CAS: 3535-88-4)?

When handling 2-Methoxy-5-(2-methyl-2-propanyl)aniline, it is crucial to use appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...