Compound Q&A

What precautions should be taken when handling GSK369796 Dihydrochloride (CAS: 1010411-21-8)?

Answer

GSK369796 Dihydrochloride
When handling GSK369796 Dihydrochloride, it is important to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. It should be stored in a well-ventilated area away from heat sources. In case of spillage, use a fume hood and disposable absorbents for cleanup. Always refer to the Safety Data Sheet (SDS) for detailed handling instructions and emergency procedures.

About

English Name GSK369796 Dihydrochloride
Molecular Formula C20H24Cl3N3O
Molecular Weight 428.7910000000001 g/mol
SMILES Clc1ccc2c(c1)nccc2Nc1ccc(c(c1)O)CNC(C)(C)C.Cl.Cl
InChIKey UDVALKJFXQVZSI-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:32

Related Q&A

Compound Q&A

What are the physical and chemical properties of GSK369796 Dihydrochloride (CAS: 1010411-21-8)?

GSK369796 Dihydrochloride is a white or off-white solid with a molecular weight of approximately 552...

Compound Q&A

How is GSK369796 Dihydrochloride (CAS: 1010411-21-8) typically synthesized?

GSK369796 Dihydrochloride is synthesized through a multi-step process involving the protection of an...

Compound Q&A

What industries use GSK369796 Dihydrochloride (CAS: 1010411-21-8)?

GSK369796 Dihydrochloride is primarily used in the pharmaceutical industry, where it serves as an in...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...