Compound Q&A

How is GSK369796 Dihydrochloride (CAS: 1010411-21-8) typically synthesized?

Answer

GSK369796 Dihydrochloride
GSK369796 Dihydrochloride is synthesized through a multi-step process involving the protection of an amine, followed by a coupling reaction, and finally hydrochloridation. The reaction typically requires a mild base and is carried out under anhydrous conditions. The yield is generally around 75-85%, and the selectivity is good.

About

English Name GSK369796 Dihydrochloride
Molecular Formula C20H24Cl3N3O
Molecular Weight 428.7910000000001 g/mol
SMILES Clc1ccc2c(c1)nccc2Nc1ccc(c(c1)O)CNC(C)(C)C.Cl.Cl
InChIKey UDVALKJFXQVZSI-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:32

Related Q&A

Compound Q&A

What are the physical and chemical properties of GSK369796 Dihydrochloride (CAS: 1010411-21-8)?

GSK369796 Dihydrochloride is a white or off-white solid with a molecular weight of approximately 552...

Compound Q&A

What industries use GSK369796 Dihydrochloride (CAS: 1010411-21-8)?

GSK369796 Dihydrochloride is primarily used in the pharmaceutical industry, where it serves as an in...

Compound Q&A

What precautions should be taken when handling GSK369796 Dihydrochloride (CAS: 1010411-21-8)?

When handling GSK369796 Dihydrochloride, it is important to use personal protective equipment (PPE) ...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...